C18H32N3OP — CID 90811726
ethane;2-[[8-(4-phosphanylpiperazin-1-yl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]ethanamine (PubChem CID 90811726) has the molecular formula C18H32N3OP and a molecular weight of 337.45 g/mol. Its IUPAC name is ethane;2-[[8-(4-phosphanylpiperazin-1-yl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]ethanamine.
| Compound Name | ethane;2-[[8-(4-phosphanylpiperazin-1-yl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]ethanamine |
|---|---|
| PubChem CID | 90811726 |
| Molecular Formula | C18H32N3OP |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | ethane;2-[[8-(4-phosphanylpiperazin-1-yl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]ethanamine |
| SMILES | CC.NCCOc1ccc2c(c1)C(N1CCN(P)CC1)CCC2 |
| InChI | InChI=1S/C16H26N3OP.C2H6/c17-6-11-20-14-5-4-13-2-1-3-16(15(13)12-14)18-7-9-19(21)10-8-18;1-2/h4-5,12,16H,1-3,6-11,17,21H2;1-2H3 |
| InChIKey | YPGAUBVSFCBLLE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|