C26H27FN8O6 — CID 90811775
N-[2-[4-[2-fluoro-4-[5-[(oxaldehydoylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-oxoethyl]-N-methylimidazo[1,2-a]pyrazine-2-carboxamide (PubChem CID 90811775) has the molecular formula C26H27FN8O6 and a molecular weight of 566.55 g/mol. Its IUPAC name is N-[2-[4-[2-fluoro-4-[5-[(oxaldehydoylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-oxoethyl]-N-methylimidazo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | N-[2-[4-[2-fluoro-4-[5-[(oxaldehydoylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-oxoethyl]-N-methylimidazo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 90811775 |
| Molecular Formula | C26H27FN8O6 |
| Molecular Weight | 566.55 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | N-[2-[4-[2-fluoro-4-[5-[(oxaldehydoylamino)methyl]-2-oxo-1,3-oxazolidin-3-yl]phenyl]piperazin-1-yl]-2-oxoethyl]-N-methylimidazo[1,2-a]pyrazine-2-carboxamide |
| SMILES | CN(CC(=O)N1CCN(c2ccc(N3CC(CNC(=O)C=O)OC3=O)cc2F)CC1)C(=O)c1cn2ccncc2n1 |
| InChI | InChI=1S/C26H27FN8O6/c1-31(25(39)20-14-34-5-4-28-12-22(34)30-20)15-24(38)33-8-6-32(7-9-33)21-3-2-17(10-19(21)27)35-13-18(41-26(35)40)11-29-23(37)16-36/h2-5,10,12,14,16,18H,6-9,11,13,15H2,1H3,(H,29,37) |
| InChIKey | DNMYNMQTDMZXLR-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 149.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.55 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|