C22H17ClFN3O5S2 — CID 90812145
2-(5-chlorothiophen-2-yl)-N-[1-[2-fluoro-4-(2-nitrophenyl)phenyl]-5-oxo-2H-pyrrol-4-yl]ethanesulfonamide (PubChem CID 90812145) has the molecular formula C22H17ClFN3O5S2 and a molecular weight of 521.98 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-[1-[2-fluoro-4-(2-nitrophenyl)phenyl]-5-oxo-2H-pyrrol-4-yl]ethanesulfonamide.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-[1-[2-fluoro-4-(2-nitrophenyl)phenyl]-5-oxo-2H-pyrrol-4-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 90812145 |
| Molecular Formula | C22H17ClFN3O5S2 |
| Molecular Weight | 521.98 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-[1-[2-fluoro-4-(2-nitrophenyl)phenyl]-5-oxo-2H-pyrrol-4-yl]ethanesulfonamide |
| SMILES | O=C1C(NS(=O)(=O)CCc2ccc(Cl)s2)=CCN1c1ccc(-c2ccccc2[N+](=O)[O-])cc1F |
| InChI | InChI=1S/C22H17ClFN3O5S2/c23-21-8-6-15(33-21)10-12-34(31,32)25-18-9-11-26(22(18)28)20-7-5-14(13-17(20)24)16-3-1-2-4-19(16)27(29)30/h1-9,13,25H,10-12H2 |
| InChIKey | YLBUPHQGLHIGKH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.98 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|