C16H13N3O4 — CID 22145451
3-(2-hydroxyphenyl)-6-(2-nitrophenyl)-1,4-dihydropyrimidin-2-one (PubChem CID 22145451) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)-6-(2-nitrophenyl)-1,4-dihydropyrimidin-2-one.
| Compound Name | 3-(2-hydroxyphenyl)-6-(2-nitrophenyl)-1,4-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 22145451 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 3-(2-hydroxyphenyl)-6-(2-nitrophenyl)-1,4-dihydropyrimidin-2-one |
| SMILES | O=C1NC(c2ccccc2[N+](=O)[O-])=CCN1c1ccccc1O |
| InChI | InChI=1S/C16H13N3O4/c20-15-8-4-3-7-14(15)18-10-9-12(17-16(18)21)11-5-1-2-6-13(11)19(22)23/h1-9,20H,10H2,(H,17,21) |
| InChIKey | CZVSZIWEHBXGHQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|