C21H15ClF4N4O4 — CID 90815080
4-[[4-[[4-chloro-3-(trifluoromethyl)phenoxy]carbamoylamino]-2-fluorophenoxy]methyl]pyridine-2-carboxamide (PubChem CID 90815080) has the molecular formula C21H15ClF4N4O4 and a molecular weight of 498.82 g/mol. Its IUPAC name is 4-[[4-[[4-chloro-3-(trifluoromethyl)phenoxy]carbamoylamino]-2-fluorophenoxy]methyl]pyridine-2-carboxamide.
| Compound Name | 4-[[4-[[4-chloro-3-(trifluoromethyl)phenoxy]carbamoylamino]-2-fluorophenoxy]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 90815080 |
| Molecular Formula | C21H15ClF4N4O4 |
| Molecular Weight | 498.82 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 4-[[4-[[4-chloro-3-(trifluoromethyl)phenoxy]carbamoylamino]-2-fluorophenoxy]methyl]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(COc2ccc(NC(=O)NOc3ccc(Cl)c(C(F)(F)F)c3)cc2F)ccn1 |
| InChI | InChI=1S/C21H15ClF4N4O4/c22-15-3-2-13(9-14(15)21(24,25)26)34-30-20(32)29-12-1-4-18(16(23)8-12)33-10-11-5-6-28-17(7-11)19(27)31/h1-9H,10H2,(H2,27,31)(H2,29,30,32) |
| InChIKey | LXBYTKDGFJUGQN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.82 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|