C26H39NO4S — CID 90815534
tert-butyl (4R)-4-(11-methoxy-11-oxoundec-1-enyl)-2-phenyl-1,3-thiazolidine-3-carboxylate (PubChem CID 90815534) has the molecular formula C26H39NO4S and a molecular weight of 461.67 g/mol. Its IUPAC name is tert-butyl (4R)-4-(11-methoxy-11-oxoundec-1-enyl)-2-phenyl-1,3-thiazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-(11-methoxy-11-oxoundec-1-enyl)-2-phenyl-1,3-thiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 90815534 |
| Molecular Formula | C26H39NO4S |
| Molecular Weight | 461.67 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | tert-butyl (4R)-4-(11-methoxy-11-oxoundec-1-enyl)-2-phenyl-1,3-thiazolidine-3-carboxylate |
| SMILES | COC(=O)CCCCCCCCC=C[C@@H]1CSC(c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H39NO4S/c1-26(2,3)31-25(29)27-22(20-32-24(27)21-16-12-11-13-17-21)18-14-9-7-5-6-8-10-15-19-23(28)30-4/h11-14,16-18,22,24H,5-10,15,19-20H2,1-4H3/t22-,24?/m1/s1 |
| InChIKey | KPXVOBHHSJMGRW-LETIRJCYSA-N |
| XLogP | 6.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.67 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|