C27H41NO3S — CID 91277269
methyl 11-[(2R,4R)-3-(3,3-dimethylbutanoyl)-2-phenyl-1,3-thiazolidin-4-yl]undec-10-enoate (PubChem CID 91277269) has the molecular formula C27H41NO3S and a molecular weight of 459.70 g/mol. Its IUPAC name is methyl 11-[(2R,4R)-3-(3,3-dimethylbutanoyl)-2-phenyl-1,3-thiazolidin-4-yl]undec-10-enoate.
| Compound Name | methyl 11-[(2R,4R)-3-(3,3-dimethylbutanoyl)-2-phenyl-1,3-thiazolidin-4-yl]undec-10-enoate |
|---|---|
| PubChem CID | 91277269 |
| Molecular Formula | C27H41NO3S |
| Molecular Weight | 459.70 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | methyl 11-[(2R,4R)-3-(3,3-dimethylbutanoyl)-2-phenyl-1,3-thiazolidin-4-yl]undec-10-enoate |
| SMILES | COC(=O)CCCCCCCCC=C[C@@H]1CS[C@H](c2ccccc2)N1C(=O)CC(C)(C)C |
| InChI | InChI=1S/C27H41NO3S/c1-27(2,3)20-24(29)28-23(21-32-26(28)22-16-12-11-13-17-22)18-14-9-7-5-6-8-10-15-19-25(30)31-4/h11-14,16-18,23,26H,5-10,15,19-21H2,1-4H3/t23-,26-/m1/s1 |
| InChIKey | MVUOEBIQBLUILE-ZEQKJWHPSA-N |
| XLogP | 6.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.70 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|