C25H37NO4S — CID 68502864
11-[(2R,4R)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenyl-1,3-thiazolidin-4-yl]undec-10-enoic acid (PubChem CID 68502864) has the molecular formula C25H37NO4S and a molecular weight of 447.64 g/mol. Its IUPAC name is 11-[(2R,4R)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenyl-1,3-thiazolidin-4-yl]undec-10-enoic acid.
| Compound Name | 11-[(2R,4R)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenyl-1,3-thiazolidin-4-yl]undec-10-enoic acid |
|---|---|
| PubChem CID | 68502864 |
| Molecular Formula | C25H37NO4S |
| Molecular Weight | 447.64 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 11-[(2R,4R)-3-[(2-methylpropan-2-yl)oxycarbonyl]-2-phenyl-1,3-thiazolidin-4-yl]undec-10-enoic acid |
| SMILES | CC(C)(C)OC(=O)N1[C@H](C=CCCCCCCCCC(=O)O)CS[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H37NO4S/c1-25(2,3)30-24(29)26-21(19-31-23(26)20-15-11-10-12-16-20)17-13-8-6-4-5-7-9-14-18-22(27)28/h10-13,15-17,21,23H,4-9,14,18-19H2,1-3H3,(H,27,28)/t21-,23-/m1/s1 |
| InChIKey | GGJLTPDGVQQMND-FYYLOGMGSA-N |
| XLogP | 6.80 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.64 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|