C16H22N4O2 — CID 90815907
N-(2,6-dimorpholin-4-yl-4-pyridinyl)prop-2-en-1-imine (PubChem CID 90815907) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is N-(2,6-dimorpholin-4-yl-4-pyridinyl)prop-2-en-1-imine.
| Compound Name | N-(2,6-dimorpholin-4-yl-4-pyridinyl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 90815907 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | N-(2,6-dimorpholin-4-yl-4-pyridinyl)prop-2-en-1-imine |
| SMILES | C=C/C=N/c1cc(N2CCOCC2)nc(N2CCOCC2)c1 |
| InChI | InChI=1S/C16H22N4O2/c1-2-3-17-14-12-15(19-4-8-21-9-5-19)18-16(13-14)20-6-10-22-11-7-20/h2-3,12-13H,1,4-11H2/b17-3+ |
| InChIKey | JMGUABXVEMSRDQ-IJUHEHPCSA-N |
| XLogP | 1.64 |
| TPSA | 50.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|