C12H13N — CID 90816836
2,3-dimethyl-8H-cyclohepta[b]pyridine (PubChem CID 90816836) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 2,3-dimethyl-8H-cyclohepta[b]pyridine.
| Compound Name | 2,3-dimethyl-8H-cyclohepta[b]pyridine |
|---|---|
| PubChem CID | 90816836 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 2,3-dimethyl-8H-cyclohepta[b]pyridine |
| SMILES | Cc1cc2c(nc1C)=CCC=CC=2 |
| InChI | InChI=1S/C12H13N/c1-9-8-11-6-4-3-5-7-12(11)13-10(9)2/h3-4,6-8H,5H2,1-2H3 |
| InChIKey | ODQKJMRXNZEPQG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |