C26H42 — CID 90817193
5-ethylidene-7-ethynyl-11,11,17-trimethylnonadeca-1,3,15-triene (PubChem CID 90817193) has the molecular formula C26H42 and a molecular weight of 354.62 g/mol. Its IUPAC name is 5-ethylidene-7-ethynyl-11,11,17-trimethylnonadeca-1,3,15-triene.
| Compound Name | 5-ethylidene-7-ethynyl-11,11,17-trimethylnonadeca-1,3,15-triene |
|---|---|
| PubChem CID | 90817193 |
| Molecular Formula | C26H42 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 354.33 |
| IUPAC Name | 5-ethylidene-7-ethynyl-11,11,17-trimethylnonadeca-1,3,15-triene |
| SMILES | C#CC(CCCC(C)(C)CCCC=CC(C)CC)CC(C=CC=C)=CC |
| InChI | InChI=1S/C26H42/c1-8-12-18-24(10-3)22-25(11-4)19-16-21-26(6,7)20-15-13-14-17-23(5)9-2/h4,8,10,12,14,17-18,23,25H,1,9,13,15-16,19-22H2,2-3,5-7H3 |
| InChIKey | SQURZYMOFJMLOW-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|