C20H42 — CID 90819140
7-ethyl-3,4,5,9-tetramethyl-8-propan-2-ylundecane (PubChem CID 90819140) has the molecular formula C20H42 and a molecular weight of 282.56 g/mol. Its IUPAC name is 7-ethyl-3,4,5,9-tetramethyl-8-propan-2-ylundecane.
| Compound Name | 7-ethyl-3,4,5,9-tetramethyl-8-propan-2-ylundecane |
|---|---|
| PubChem CID | 90819140 |
| Molecular Formula | C20H42 |
| Molecular Weight | 282.56 g/mol |
| Exact Mass | 282.33 |
| IUPAC Name | 7-ethyl-3,4,5,9-tetramethyl-8-propan-2-ylundecane |
| SMILES | CCC(C)C(C)C(C)CC(CC)C(C(C)C)C(C)CC |
| InChI | InChI=1S/C20H42/c1-10-15(6)18(9)17(8)13-19(12-3)20(14(4)5)16(7)11-2/h14-20H,10-13H2,1-9H3 |
| InChIKey | YNWRATPJWCGTSS-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.56 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |