C34H70 — CID 58013693
7,12,15,16-tetraethyl-2,3,4,6,8,10,11,14-octamethyloctadecane (PubChem CID 58013693) has the molecular formula C34H70 and a molecular weight of 478.93 g/mol. Its IUPAC name is 7,12,15,16-tetraethyl-2,3,4,6,8,10,11,14-octamethyloctadecane.
| Compound Name | 7,12,15,16-tetraethyl-2,3,4,6,8,10,11,14-octamethyloctadecane |
|---|---|
| PubChem CID | 58013693 |
| Molecular Formula | C34H70 |
| Molecular Weight | 478.93 g/mol |
| Exact Mass | 478.55 |
| IUPAC Name | 7,12,15,16-tetraethyl-2,3,4,6,8,10,11,14-octamethyloctadecane |
| SMILES | CCC(CC(C)C(CC)C(CC)CC)C(C)C(C)CC(C)C(CC)C(C)CC(C)C(C)C(C)C |
| InChI | InChI=1S/C34H70/c1-15-31(16-2)34(19-5)28(12)22-32(17-3)30(14)25(9)21-27(11)33(18-4)26(10)20-24(8)29(13)23(6)7/h23-34H,15-22H2,1-14H3 |
| InChIKey | SMDHNQWRIAUCIJ-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.93 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |