C18H15F4NO2 — CID 90823715
5-fluoro-7-methyl-2-[1-[4-(trifluoromethoxy)phenyl]ethyl]isoindol-1-ol (PubChem CID 90823715) has the molecular formula C18H15F4NO2 and a molecular weight of 353.32 g/mol. Its IUPAC name is 5-fluoro-7-methyl-2-[1-[4-(trifluoromethoxy)phenyl]ethyl]isoindol-1-ol.
| Compound Name | 5-fluoro-7-methyl-2-[1-[4-(trifluoromethoxy)phenyl]ethyl]isoindol-1-ol |
|---|---|
| PubChem CID | 90823715 |
| Molecular Formula | C18H15F4NO2 |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 5-fluoro-7-methyl-2-[1-[4-(trifluoromethoxy)phenyl]ethyl]isoindol-1-ol |
| SMILES | Cc1cc(F)cc2cn(C(C)c3ccc(OC(F)(F)F)cc3)c(O)c12 |
| InChI | InChI=1S/C18H15F4NO2/c1-10-7-14(19)8-13-9-23(17(24)16(10)13)11(2)12-3-5-15(6-4-12)25-18(20,21)22/h3-9,11,24H,1-2H3 |
| InChIKey | XFKBCSCWVJCWRZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |