C17H10ClF6NO2 — CID 90703191
5-chloro-2-[[4-(trifluoromethoxy)phenyl]methyl]-7-(trifluoromethyl)isoindol-1-ol (PubChem CID 90703191) has the molecular formula C17H10ClF6NO2 and a molecular weight of 409.71 g/mol. Its IUPAC name is 5-chloro-2-[[4-(trifluoromethoxy)phenyl]methyl]-7-(trifluoromethyl)isoindol-1-ol.
| Compound Name | 5-chloro-2-[[4-(trifluoromethoxy)phenyl]methyl]-7-(trifluoromethyl)isoindol-1-ol |
|---|---|
| PubChem CID | 90703191 |
| Molecular Formula | C17H10ClF6NO2 |
| Molecular Weight | 409.71 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 5-chloro-2-[[4-(trifluoromethoxy)phenyl]methyl]-7-(trifluoromethyl)isoindol-1-ol |
| SMILES | Oc1c2c(C(F)(F)F)cc(Cl)cc2cn1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H10ClF6NO2/c18-11-5-10-8-25(15(26)14(10)13(6-11)16(19,20)21)7-9-1-3-12(4-2-9)27-17(22,23)24/h1-6,8,26H,7H2 |
| InChIKey | YRTUZSODVCJYHK-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.71 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |