C16H11Cl2F2NO2 — CID 90781008
5,7-dichloro-2-[[4-(difluoromethoxy)phenyl]methyl]isoindol-1-ol (PubChem CID 90781008) has the molecular formula C16H11Cl2F2NO2 and a molecular weight of 358.17 g/mol. Its IUPAC name is 5,7-dichloro-2-[[4-(difluoromethoxy)phenyl]methyl]isoindol-1-ol.
| Compound Name | 5,7-dichloro-2-[[4-(difluoromethoxy)phenyl]methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 90781008 |
| Molecular Formula | C16H11Cl2F2NO2 |
| Molecular Weight | 358.17 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 5,7-dichloro-2-[[4-(difluoromethoxy)phenyl]methyl]isoindol-1-ol |
| SMILES | Oc1c2c(Cl)cc(Cl)cc2cn1Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H11Cl2F2NO2/c17-11-5-10-8-21(15(22)14(10)13(18)6-11)7-9-1-3-12(4-2-9)23-16(19)20/h1-6,8,16,22H,7H2 |
| InChIKey | SCFMCXAMUGITMR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.17 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |