C16H10ClF4NO2 — CID 90762498
7-chloro-6-fluoro-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol (PubChem CID 90762498) has the molecular formula C16H10ClF4NO2 and a molecular weight of 359.71 g/mol. Its IUPAC name is 7-chloro-6-fluoro-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol.
| Compound Name | 7-chloro-6-fluoro-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 90762498 |
| Molecular Formula | C16H10ClF4NO2 |
| Molecular Weight | 359.71 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 7-chloro-6-fluoro-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
| SMILES | Oc1c2c(Cl)c(F)ccc2cn1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H10ClF4NO2/c17-14-12(18)6-3-10-8-22(15(23)13(10)14)7-9-1-4-11(5-2-9)24-16(19,20)21/h1-6,8,23H,7H2 |
| InChIKey | KSSPVCCAGOPJES-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.71 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |