C8H9Cl2N — CID 90827199
2,3-dichloro-6-methylidenecyclohexane-1-carbonitrile (PubChem CID 90827199) has the molecular formula C8H9Cl2N and a molecular weight of 190.07 g/mol. Its IUPAC name is 2,3-dichloro-6-methylidenecyclohexane-1-carbonitrile.
| Compound Name | 2,3-dichloro-6-methylidenecyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 90827199 |
| Molecular Formula | C8H9Cl2N |
| Molecular Weight | 190.07 g/mol |
| Exact Mass | 189.01 |
| IUPAC Name | 2,3-dichloro-6-methylidenecyclohexane-1-carbonitrile |
| SMILES | C=C1CCC(Cl)C(Cl)C1C#N |
| InChI | InChI=1S/C8H9Cl2N/c1-5-2-3-7(9)8(10)6(5)4-11/h6-8H,1-3H2 |
| InChIKey | AZNNPXZKBTZGLN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.07 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|