C7H8Cl4 — CID 90888986
1,2,3,4-tetrachloro-5-methylidenecyclohexane (PubChem CID 90888986) has the molecular formula C7H8Cl4 and a molecular weight of 233.95 g/mol. Its IUPAC name is 1,2,3,4-tetrachloro-5-methylidenecyclohexane.
| Compound Name | 1,2,3,4-tetrachloro-5-methylidenecyclohexane |
|---|---|
| PubChem CID | 90888986 |
| Molecular Formula | C7H8Cl4 |
| Molecular Weight | 233.95 g/mol |
| Exact Mass | 231.94 |
| IUPAC Name | 1,2,3,4-tetrachloro-5-methylidenecyclohexane |
| SMILES | C=C1CC(Cl)C(Cl)C(Cl)C1Cl |
| InChI | InChI=1S/C7H8Cl4/c1-3-2-4(8)6(10)7(11)5(3)9/h4-7H,1-2H2 |
| InChIKey | CZVMGZUHSFNNRA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.95 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|