C9H14Cl2 — CID 91153934
2,4-dichloro-1,3-dimethyl-5-methylidenecyclohexane (PubChem CID 91153934) has the molecular formula C9H14Cl2 and a molecular weight of 193.12 g/mol. Its IUPAC name is 2,4-dichloro-1,3-dimethyl-5-methylidenecyclohexane.
| Compound Name | 2,4-dichloro-1,3-dimethyl-5-methylidenecyclohexane |
|---|---|
| PubChem CID | 91153934 |
| Molecular Formula | C9H14Cl2 |
| Molecular Weight | 193.12 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2,4-dichloro-1,3-dimethyl-5-methylidenecyclohexane |
| SMILES | C=C1CC(C)C(Cl)C(C)C1Cl |
| InChI | InChI=1S/C9H14Cl2/c1-5-4-6(2)9(11)7(3)8(5)10/h6-9H,1,4H2,2-3H3 |
| InChIKey | WJXLSCZEXHRZAP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.12 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|