C7H9Cl5 — CID 59887322
(1S,2R,4R,5S)-1,2,3,4,5-pentachloro-6-methylcyclohexane (PubChem CID 59887322) has the molecular formula C7H9Cl5 and a molecular weight of 270.41 g/mol. Its IUPAC name is (1S,2R,4R,5S)-1,2,3,4,5-pentachloro-6-methylcyclohexane.
| Compound Name | (1S,2R,4R,5S)-1,2,3,4,5-pentachloro-6-methylcyclohexane |
|---|---|
| PubChem CID | 59887322 |
| Molecular Formula | C7H9Cl5 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 267.91 |
| IUPAC Name | (1S,2R,4R,5S)-1,2,3,4,5-pentachloro-6-methylcyclohexane |
| SMILES | CC1[C@H](Cl)[C@@H](Cl)C(Cl)[C@H](Cl)[C@H]1Cl |
| InChI | InChI=1S/C7H9Cl5/c1-2-3(8)5(10)7(12)6(11)4(2)9/h2-7H,1H3/t2?,3-,4-,5+,6+,7?/m0/s1 |
| InChIKey | YODAFTPDHFMTHD-MBXCVVGISA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|