C8H12Cl4 — CID 101119992
(1S,2S,4S,5S)-1,2,4,5-tetrachloro-3,6-dimethylcyclohexane (PubChem CID 101119992) has the molecular formula C8H12Cl4 and a molecular weight of 250.00 g/mol. Its IUPAC name is (1S,2S,4S,5S)-1,2,4,5-tetrachloro-3,6-dimethylcyclohexane.
| Compound Name | (1S,2S,4S,5S)-1,2,4,5-tetrachloro-3,6-dimethylcyclohexane |
|---|---|
| PubChem CID | 101119992 |
| Molecular Formula | C8H12Cl4 |
| Molecular Weight | 250.00 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | (1S,2S,4S,5S)-1,2,4,5-tetrachloro-3,6-dimethylcyclohexane |
| SMILES | CC1[C@H](Cl)[C@@H](Cl)C(C)[C@H](Cl)[C@H]1Cl |
| InChI | InChI=1S/C8H12Cl4/c1-3-5(9)7(11)4(2)8(12)6(3)10/h3-8H,1-2H3/t3?,4?,5-,6-,7-,8-/m0/s1 |
| InChIKey | MMEGZFLMYLANGP-FNPDQKKYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.00 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|