C9H16ClN — CID 90834219
4-chloro-N,N-dimethyl-3-methylidenecyclohexan-1-amine (PubChem CID 90834219) has the molecular formula C9H16ClN and a molecular weight of 173.69 g/mol. Its IUPAC name is 4-chloro-N,N-dimethyl-3-methylidenecyclohexan-1-amine.
| Compound Name | 4-chloro-N,N-dimethyl-3-methylidenecyclohexan-1-amine |
|---|---|
| PubChem CID | 90834219 |
| Molecular Formula | C9H16ClN |
| Molecular Weight | 173.69 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 4-chloro-N,N-dimethyl-3-methylidenecyclohexan-1-amine |
| SMILES | C=C1CC(N(C)C)CCC1Cl |
| InChI | InChI=1S/C9H16ClN/c1-7-6-8(11(2)3)4-5-9(7)10/h8-9H,1,4-6H2,2-3H3 |
| InChIKey | GXRXCCCSUKAOHS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.69 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|