C21H20F2N4O2 — CID 90827291
2-[4-[(3-cyano-4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 90827291) has the molecular formula C21H20F2N4O2 and a molecular weight of 398.41 g/mol. Its IUPAC name is 2-[4-[(3-cyano-4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-[(3-cyano-4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 90827291 |
| Molecular Formula | C21H20F2N4O2 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-[4-[(3-cyano-4-fluorophenyl)methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | N#Cc1cc(CONC2=CCN(CC(=O)Nc3ccc(F)cc3)CC2)ccc1F |
| InChI | InChI=1S/C21H20F2N4O2/c22-17-2-4-18(5-3-17)25-21(28)13-27-9-7-19(8-10-27)26-29-14-15-1-6-20(23)16(11-15)12-24/h1-7,11,26H,8-10,13-14H2,(H,25,28) |
| InChIKey | ANSUXRVHEWIPAC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|