C66H79N7O4 — CID 90827452
2-[4-[10-(4-decoxyphenyl)-15,20-bis[4-[2-(dimethylamino)ethoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]-N,N-dimethylethanamine (PubChem CID 90827452) has the molecular formula C66H79N7O4 and a molecular weight of 1034.40 g/mol. Its IUPAC name is 2-[4-[10-(4-decoxyphenyl)-15,20-bis[4-[2-(dimethylamino)ethoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[10-(4-decoxyphenyl)-15,20-bis[4-[2-(dimethylamino)ethoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 90827452 |
| Molecular Formula | C66H79N7O4 |
| Molecular Weight | 1034.40 g/mol |
| Exact Mass | 1033.62 |
| IUPAC Name | 2-[4-[10-(4-decoxyphenyl)-15,20-bis[4-[2-(dimethylamino)ethoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]-N,N-dimethylethanamine |
| SMILES | CCCCCCCCCCOc1ccc(C2=c3ccc([nH]3)=C(c3ccc(OCCN(C)C)cc3)c3ccc([nH]3)C(c3ccc(OCCN(C)C)cc3)=c3ccc([nH]3)=C(c3ccc(OCCN(C)C)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C66H79N7O4/c1-8-9-10-11-12-13-14-15-43-74-51-24-16-47(17-25-51)63-55-32-34-57(67-55)64(48-18-26-52(27-19-48)75-44-40-71(2)3)59-36-38-61(69-59)66(50-22-30-54(31-23-50)77-46-42-73(6)7)62-39-37-60(70-62)65(58-35-33-56(63)68-58)49-20-28-53(29-21-49)76-45-41-72(4)5/h16-39,67-70H,8-15,40-46H2,1-7H3 |
| InChIKey | KZXMAJMEVCBNKR-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1034.40 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|