C30H33F2NO7 — CID 90828405
(2R,4R,4aR,5aR,11aS,12aR)-7-(2,4-difluorophenyl)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 90828405) has the molecular formula C30H33F2NO7 and a molecular weight of 557.59 g/mol. Its IUPAC name is (2R,4R,4aR,5aR,11aS,12aR)-7-(2,4-difluorophenyl)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (2R,4R,4aR,5aR,11aS,12aR)-7-(2,4-difluorophenyl)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 90828405 |
| Molecular Formula | C30H33F2NO7 |
| Molecular Weight | 557.59 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | (2R,4R,4aR,5aR,11aS,12aR)-7-(2,4-difluorophenyl)-3,10,12,12a-tetrahydroxy-4a,5a-dimethyl-1,11-dioxo-4-propan-2-yl-3,4,5,6,11a,12-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CC(C)[C@H]1C(O)[C@@H](C(N)=O)C(=O)[C@]2(O)C(O)[C@H]3C(=O)c4c(O)ccc(-c5ccc(F)cc5F)c4C[C@]3(C)C[C@]12C |
| InChI | InChI=1S/C30H33F2NO7/c1-12(2)21-24(36)20(27(33)39)25(37)30(40)26(38)22-23(35)19-16(10-28(22,3)11-29(21,30)4)14(7-8-18(19)34)15-6-5-13(31)9-17(15)32/h5-9,12,20-22,24,26,34,36,38,40H,10-11H2,1-4H3,(H2,33,39)/t20-,21+,22-,24?,26?,28-,29-,30+/m1/s1 |
| InChIKey | WKPBEBFLGWIVER-GRFGVWDZSA-N |
| XLogP | 2.52 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.59 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|