C10H18N2 — CID 90828841
1-cyclopenta-1,4-dien-1-yl-2-pentan-3-ylhydrazine (PubChem CID 90828841) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-cyclopenta-1,4-dien-1-yl-2-pentan-3-ylhydrazine.
| Compound Name | 1-cyclopenta-1,4-dien-1-yl-2-pentan-3-ylhydrazine |
|---|---|
| PubChem CID | 90828841 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-cyclopenta-1,4-dien-1-yl-2-pentan-3-ylhydrazine |
| SMILES | CCC(CC)NNC1=CCC=C1 |
| InChI | InChI=1S/C10H18N2/c1-3-9(4-2)11-12-10-7-5-6-8-10/h5,7-9,11-12H,3-4,6H2,1-2H3 |
| InChIKey | DJHFOPKPXHSLAV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|