C19H25NO5 — CID 90831900
butyl 2-[2,5-dihydroxy-1-(4-hydroxyphenyl)-4-methylpyrrol-3-yl]butanoate (PubChem CID 90831900) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is butyl 2-[2,5-dihydroxy-1-(4-hydroxyphenyl)-4-methylpyrrol-3-yl]butanoate.
| Compound Name | butyl 2-[2,5-dihydroxy-1-(4-hydroxyphenyl)-4-methylpyrrol-3-yl]butanoate |
|---|---|
| PubChem CID | 90831900 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | butyl 2-[2,5-dihydroxy-1-(4-hydroxyphenyl)-4-methylpyrrol-3-yl]butanoate |
| SMILES | CCCCOC(=O)C(CC)c1c(C)c(O)n(-c2ccc(O)cc2)c1O |
| InChI | InChI=1S/C19H25NO5/c1-4-6-11-25-19(24)15(5-2)16-12(3)17(22)20(18(16)23)13-7-9-14(21)10-8-13/h7-10,15,21-23H,4-6,11H2,1-3H3 |
| InChIKey | OJDJGXFHIHHALL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|