C21H25N3O4 — CID 90833679
2-[5-[formyl(phenylmethoxy)amino]hexanoylamino]benzamide (PubChem CID 90833679) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-[5-[formyl(phenylmethoxy)amino]hexanoylamino]benzamide.
| Compound Name | 2-[5-[formyl(phenylmethoxy)amino]hexanoylamino]benzamide |
|---|---|
| PubChem CID | 90833679 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-[5-[formyl(phenylmethoxy)amino]hexanoylamino]benzamide |
| SMILES | CC(CCCC(=O)Nc1ccccc1C(N)=O)N(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H25N3O4/c1-16(24(15-25)28-14-17-9-3-2-4-10-17)8-7-13-20(26)23-19-12-6-5-11-18(19)21(22)27/h2-6,9-12,15-16H,7-8,13-14H2,1H3,(H2,22,27)(H,23,26) |
| InChIKey | NSSYPQLTLUJVPI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|