C23H42N4O12 — CID 90834939
2-[4,7-bis(carboxymethyl)-10-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 90834939) has the molecular formula C23H42N4O12 and a molecular weight of 566.61 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 90834939 |
| Molecular Formula | C23H42N4O12 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1)O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C23H42N4O12/c1-15(38-23-22(37)21(36)20(35)16(14-28)39-23)10-24-2-4-25(11-17(29)30)6-8-27(13-19(33)34)9-7-26(5-3-24)12-18(31)32/h15-16,20-23,28,35-37H,2-14H2,1H3,(H,29,30)(H,31,32)(H,33,34)/t15?,16-,20+,21+,22-,23-/m1/s1 |
| InChIKey | RPBJYALSSBAJFP-PUMTZMTJSA-N |
| XLogP | -4.33 |
| TPSA | 224.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | -4.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |