C22H40N4O12 — CID 91606961
2-[4,7-bis(carboxymethyl)-10-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 91606961) has the molecular formula C22H40N4O12 and a molecular weight of 552.58 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 91606961 |
| Molecular Formula | C22H40N4O12 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CCO[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C22H40N4O12/c27-14-15-19(34)20(35)21(36)22(38-15)37-10-9-23-1-3-24(11-16(28)29)5-7-26(13-18(32)33)8-6-25(4-2-23)12-17(30)31/h15,19-22,27,34-36H,1-14H2,(H,28,29)(H,30,31)(H,32,33)/t15-,19+,20+,21-,22-/m1/s1 |
| InChIKey | XGAYMQODWIHPCI-MPRQEMDOSA-N |
| XLogP | -4.72 |
| TPSA | 224.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | -4.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |