C15H28O6P+ — CID 90836035
(6-methoxy-6-oxohexoxy)-methyl-oxophosphanium;propyl 2-methylprop-2-enoate (PubChem CID 90836035) has the molecular formula C15H28O6P+ and a molecular weight of 335.36 g/mol. Its IUPAC name is (6-methoxy-6-oxohexoxy)-methyl-oxophosphanium;propyl 2-methylprop-2-enoate.
| Compound Name | (6-methoxy-6-oxohexoxy)-methyl-oxophosphanium;propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90836035 |
| Molecular Formula | C15H28O6P+ |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (6-methoxy-6-oxohexoxy)-methyl-oxophosphanium;propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC.COC(=O)CCCCCO[P+](C)=O |
| InChI | InChI=1S/C8H16O4P.C7H12O2/c1-11-8(9)6-4-3-5-7-12-13(2)10;1-4-5-9-7(8)6(2)3/h3-7H2,1-2H3;2,4-5H2,1,3H3/q+1; |
| InChIKey | ATWFHZJEBYFCPR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|