C24H23ClN2O11 — CID 90838865
3-[3-[[[4-[(3-chlorophenyl)-hydroxymethyl]-2,4-dihydroxyazetidin-2-yl]-dihydroxymethyl]amino]-2,4,5,6-tetrahydroxyphenyl]benzoic acid (PubChem CID 90838865) has the molecular formula C24H23ClN2O11 and a molecular weight of 550.90 g/mol. Its IUPAC name is 3-[3-[[[4-[(3-chlorophenyl)-hydroxymethyl]-2,4-dihydroxyazetidin-2-yl]-dihydroxymethyl]amino]-2,4,5,6-tetrahydroxyphenyl]benzoic acid.
| Compound Name | 3-[3-[[[4-[(3-chlorophenyl)-hydroxymethyl]-2,4-dihydroxyazetidin-2-yl]-dihydroxymethyl]amino]-2,4,5,6-tetrahydroxyphenyl]benzoic acid |
|---|---|
| PubChem CID | 90838865 |
| Molecular Formula | C24H23ClN2O11 |
| Molecular Weight | 550.90 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | 3-[3-[[[4-[(3-chlorophenyl)-hydroxymethyl]-2,4-dihydroxyazetidin-2-yl]-dihydroxymethyl]amino]-2,4,5,6-tetrahydroxyphenyl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2c(O)c(O)c(O)c(NC(O)(O)C3(O)CC(O)(C(O)c4cccc(Cl)c4)N3)c2O)c1 |
| InChI | InChI=1S/C24H23ClN2O11/c25-13-6-2-4-11(8-13)20(32)22(35)9-23(36,27-22)24(37,38)26-15-16(28)14(17(29)19(31)18(15)30)10-3-1-5-12(7-10)21(33)34/h1-8,20,26-32,35-38H,9H2,(H,33,34) |
| InChIKey | ZOBBJUNNPFQERV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 243.43 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.90 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|