C21H22N4O3 — CID 90839151
[5-(3-amino-2-methylphenyl)-8-carbamoyl-2,3,4,9-tetrahydro-1H-carbazol-2-yl]carbamic acid (PubChem CID 90839151) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is [5-(3-amino-2-methylphenyl)-8-carbamoyl-2,3,4,9-tetrahydro-1H-carbazol-2-yl]carbamic acid.
| Compound Name | [5-(3-amino-2-methylphenyl)-8-carbamoyl-2,3,4,9-tetrahydro-1H-carbazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 90839151 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | [5-(3-amino-2-methylphenyl)-8-carbamoyl-2,3,4,9-tetrahydro-1H-carbazol-2-yl]carbamic acid |
| SMILES | Cc1c(N)cccc1-c1ccc(C(N)=O)c2[nH]c3c(c12)CCC(NC(=O)O)C3 |
| InChI | InChI=1S/C21H22N4O3/c1-10-12(3-2-4-16(10)22)13-7-8-15(20(23)26)19-18(13)14-6-5-11(24-21(27)28)9-17(14)25-19/h2-4,7-8,11,24-25H,5-6,9,22H2,1H3,(H2,23,26)(H,27,28) |
| InChIKey | FEFYYDPBAWFQSU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 134.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|