C28H35ClN4O3 — CID 90839425
2-chloro-N-[4-[(4-cyclopropyl-2-methylbut-3-yn-2-yl)amino]-3-hydroxy-1-phenylbutan-2-yl]-6-morpholin-4-ylpyridine-4-carboxamide (PubChem CID 90839425) has the molecular formula C28H35ClN4O3 and a molecular weight of 511.07 g/mol. Its IUPAC name is 2-chloro-N-[4-[(4-cyclopropyl-2-methylbut-3-yn-2-yl)amino]-3-hydroxy-1-phenylbutan-2-yl]-6-morpholin-4-ylpyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[4-[(4-cyclopropyl-2-methylbut-3-yn-2-yl)amino]-3-hydroxy-1-phenylbutan-2-yl]-6-morpholin-4-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 90839425 |
| Molecular Formula | C28H35ClN4O3 |
| Molecular Weight | 511.07 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 2-chloro-N-[4-[(4-cyclopropyl-2-methylbut-3-yn-2-yl)amino]-3-hydroxy-1-phenylbutan-2-yl]-6-morpholin-4-ylpyridine-4-carboxamide |
| SMILES | CC(C)(C#CC1CC1)NCC(O)C(Cc1ccccc1)NC(=O)c1cc(Cl)nc(N2CCOCC2)c1 |
| InChI | InChI=1S/C28H35ClN4O3/c1-28(2,11-10-20-8-9-20)30-19-24(34)23(16-21-6-4-3-5-7-21)31-27(35)22-17-25(29)32-26(18-22)33-12-14-36-15-13-33/h3-7,17-18,20,23-24,30,34H,8-9,12-16,19H2,1-2H3,(H,31,35) |
| InChIKey | MKDDBCQYTWFNQP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.07 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|