C27H33FN4O2 — CID 70214451
N-[(2S,3R)-4-(3-cyclopropylprop-2-ynylamino)-3-hydroxy-1-phenylbutan-2-yl]-2-fluoro-6-[[(1S,2S)-2-methylcyclopropyl]methylamino]pyridine-4-carboxamide (PubChem CID 70214451) has the molecular formula C27H33FN4O2 and a molecular weight of 464.59 g/mol. Its IUPAC name is N-[(2S,3R)-4-(3-cyclopropylprop-2-ynylamino)-3-hydroxy-1-phenylbutan-2-yl]-2-fluoro-6-[[(1S,2S)-2-methylcyclopropyl]methylamino]pyridine-4-carboxamide.
| Compound Name | N-[(2S,3R)-4-(3-cyclopropylprop-2-ynylamino)-3-hydroxy-1-phenylbutan-2-yl]-2-fluoro-6-[[(1S,2S)-2-methylcyclopropyl]methylamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 70214451 |
| Molecular Formula | C27H33FN4O2 |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | N-[(2S,3R)-4-(3-cyclopropylprop-2-ynylamino)-3-hydroxy-1-phenylbutan-2-yl]-2-fluoro-6-[[(1S,2S)-2-methylcyclopropyl]methylamino]pyridine-4-carboxamide |
| SMILES | C[C@H]1C[C@@H]1CNc1cc(C(=O)N[C@@H](Cc2ccccc2)[C@H](O)CNCC#CC2CC2)cc(F)n1 |
| InChI | InChI=1S/C27H33FN4O2/c1-18-12-22(18)16-30-26-15-21(14-25(28)32-26)27(34)31-23(13-20-6-3-2-4-7-20)24(33)17-29-11-5-8-19-9-10-19/h2-4,6-7,14-15,18-19,22-24,29,33H,9-13,16-17H2,1H3,(H,30,32)(H,31,34)/t18-,22+,23-,24+/m0/s1 |
| InChIKey | CPYVNIXOXUIYNE-UFONIEFXSA-N |
| XLogP | 2.99 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|