C28H39N5O3S — CID 91102690
2-[(2-methylcyclopropyl)methylamino]-6-[methyl(propan-2-ylsulfonyl)amino]-N-[1-phenyl-4-(prop-2-ynylamino)butan-2-yl]pyridine-4-carboxamide (PubChem CID 91102690) has the molecular formula C28H39N5O3S and a molecular weight of 525.72 g/mol. Its IUPAC name is 2-[(2-methylcyclopropyl)methylamino]-6-[methyl(propan-2-ylsulfonyl)amino]-N-[1-phenyl-4-(prop-2-ynylamino)butan-2-yl]pyridine-4-carboxamide.
| Compound Name | 2-[(2-methylcyclopropyl)methylamino]-6-[methyl(propan-2-ylsulfonyl)amino]-N-[1-phenyl-4-(prop-2-ynylamino)butan-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 91102690 |
| Molecular Formula | C28H39N5O3S |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | 2-[(2-methylcyclopropyl)methylamino]-6-[methyl(propan-2-ylsulfonyl)amino]-N-[1-phenyl-4-(prop-2-ynylamino)butan-2-yl]pyridine-4-carboxamide |
| SMILES | C#CCNCCC(Cc1ccccc1)NC(=O)c1cc(NCC2CC2C)nc(N(C)S(=O)(=O)C(C)C)c1 |
| InChI | InChI=1S/C28H39N5O3S/c1-6-13-29-14-12-25(16-22-10-8-7-9-11-22)31-28(34)23-17-26(30-19-24-15-21(24)4)32-27(18-23)33(5)37(35,36)20(2)3/h1,7-11,17-18,20-21,24-25,29H,12-16,19H2,2-5H3,(H,30,32)(H,31,34) |
| InChIKey | FCQFVJJMJVJTCT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|