About 4,5-diamino-1,3-dimethyl-6-methyliminopyrimidin-2-one
4,5-diamino-1,3-dimethyl-6-methyliminopyrimidin-2-one (PubChem CID 90841358) has the molecular formula C7H13N5O
and a molecular weight of 183.21 g/mol. Its IUPAC name is 4,5-diamino-1,3-dimethyl-6-methyliminopyrimidin-2-one.
Analyze 4,5-diamino-1,3-dimethyl-6-methyliminopyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diamino-1,3-dimethyl-6-methyliminopyrimidin-2-one?
The IUPAC name of 4,5-diamino-1,3-dimethyl-6-methyliminopyrimidin-2-one (CID 90841358) is 4,5-diamino-1,3-dimethyl-6-methyliminopyrimidin-2-one.
What is the SMILES notation for 4,5-diamino-1,3-dimethyl-6-methyliminopyrimidin-2-one?
The canonical SMILES for 4,5-diamino-1,3-dimethyl-6-methyliminopyrimidin-2-one is C/N=c1/c(N)c(N)n(C)c(=O)n1C.
What is the InChIKey of 4,5-diamino-1,3-dimethyl-6-methyliminopyrimidin-2-one?
The InChIKey is AMNKFVLQFGKADN-POHAHGRESA-N. The full InChI is InChI=1S/C7H13N5O/c1-10-6-4(8)5(9)11(2)7(13)12(6)3/h8-9H2,1-3H3/b10-6-.
What are the key properties of 4,5-diamino-1,3-dimethyl-6-methyliminopyrimidin-2-one?
4,5-diamino-1,3-dimethyl-6-methyliminopyrimidin-2-one has a molecular weight of 183.21 g/mol, XLogP of -1.58, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diamino-1,3-dimethyl-6-methyliminopyrimidin-2-one is sourced from PubChem (CID 90841358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).