C19H21NO — CID 90841663
5-benzyl-3-(3-phenylpropyl)-2,5-dihydro-1,2-oxazole (PubChem CID 90841663) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 5-benzyl-3-(3-phenylpropyl)-2,5-dihydro-1,2-oxazole.
| Compound Name | 5-benzyl-3-(3-phenylpropyl)-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 90841663 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 5-benzyl-3-(3-phenylpropyl)-2,5-dihydro-1,2-oxazole |
| SMILES | C1=C(CCCc2ccccc2)NOC1Cc1ccccc1 |
| InChI | InChI=1S/C19H21NO/c1-3-8-16(9-4-1)12-7-13-18-15-19(21-20-18)14-17-10-5-2-6-11-17/h1-6,8-11,15,19-20H,7,12-14H2 |
| InChIKey | IRVJPYPGDPMOLN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |