C15H12FNO — CID 91347486
3-(4-fluorophenyl)-5-phenyl-2,5-dihydro-1,2-oxazole (PubChem CID 91347486) has the molecular formula C15H12FNO and a molecular weight of 241.27 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-phenyl-2,5-dihydro-1,2-oxazole.
| Compound Name | 3-(4-fluorophenyl)-5-phenyl-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 91347486 |
| Molecular Formula | C15H12FNO |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 3-(4-fluorophenyl)-5-phenyl-2,5-dihydro-1,2-oxazole |
| SMILES | Fc1ccc(C2=CC(c3ccccc3)ON2)cc1 |
| InChI | InChI=1S/C15H12FNO/c16-13-8-6-11(7-9-13)14-10-15(18-17-14)12-4-2-1-3-5-12/h1-10,15,17H |
| InChIKey | VSOXKFAMILXOPS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |