C16H20N2O6S — CID 9084216
methyl (2S)-4-[4-(2-amino-2-oxoethoxy)-3-methoxybenzoyl]thiomorpholine-2-carboxylate (PubChem CID 9084216) has the molecular formula C16H20N2O6S and a molecular weight of 368.41 g/mol. Its IUPAC name is methyl (2S)-4-[4-(2-amino-2-oxoethoxy)-3-methoxybenzoyl]thiomorpholine-2-carboxylate.
| Compound Name | methyl (2S)-4-[4-(2-amino-2-oxoethoxy)-3-methoxybenzoyl]thiomorpholine-2-carboxylate |
|---|---|
| PubChem CID | 9084216 |
| Molecular Formula | C16H20N2O6S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | methyl (2S)-4-[4-(2-amino-2-oxoethoxy)-3-methoxybenzoyl]thiomorpholine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CN(C(=O)c2ccc(OCC(N)=O)c(OC)c2)CCS1 |
| InChI | InChI=1S/C16H20N2O6S/c1-22-12-7-10(3-4-11(12)24-9-14(17)19)15(20)18-5-6-25-13(8-18)16(21)23-2/h3-4,7,13H,5-6,8-9H2,1-2H3,(H2,17,19)/t13-/m0/s1 |
| InChIKey | TWQDATYYSMUVKA-ZDUSSCGKSA-N |
| XLogP | 0.29 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |