C20H26N2 — CID 90843689
3-methyl-2-(4-pyrrolidin-1-ylbut-1-enyl)-4,5-dihydro-1-benzazocine (PubChem CID 90843689) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 3-methyl-2-(4-pyrrolidin-1-ylbut-1-enyl)-4,5-dihydro-1-benzazocine.
| Compound Name | 3-methyl-2-(4-pyrrolidin-1-ylbut-1-enyl)-4,5-dihydro-1-benzazocine |
|---|---|
| PubChem CID | 90843689 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 3-methyl-2-(4-pyrrolidin-1-ylbut-1-enyl)-4,5-dihydro-1-benzazocine |
| SMILES | CC1=C(C=CCCN2CCCC2)/N=c2/ccccc2=CCC1 |
| InChI | InChI=1S/C20H26N2/c1-17-9-8-11-18-10-2-3-13-20(18)21-19(17)12-4-5-14-22-15-6-7-16-22/h2-4,10-13H,5-9,14-16H2,1H3/b12-4?,18-11?,19-17?,21-20- |
| InChIKey | YQKAYCPCQCZBPE-XKUQRNOJSA-N |
| XLogP | 3.20 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |