C31H47NO2 — CID 90846027
3-[(1S)-3-[2-[(1R,7aR)-1-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-1-hydroxy-4-methylidenecyclohexyl]oxypropanenitrile (PubChem CID 90846027) has the molecular formula C31H47NO2 and a molecular weight of 465.72 g/mol. Its IUPAC name is 3-[(1S)-3-[2-[(1R,7aR)-1-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-1-hydroxy-4-methylidenecyclohexyl]oxypropanenitrile.
| Compound Name | 3-[(1S)-3-[2-[(1R,7aR)-1-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-1-hydroxy-4-methylidenecyclohexyl]oxypropanenitrile |
|---|---|
| PubChem CID | 90846027 |
| Molecular Formula | C31H47NO2 |
| Molecular Weight | 465.72 g/mol |
| Exact Mass | 465.36 |
| IUPAC Name | 3-[(1S)-3-[2-[(1R,7aR)-1-[(2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-1-hydroxy-4-methylidenecyclohexyl]oxypropanenitrile |
| SMILES | C=C1CC[C@](O)(OCCC#N)CC1=CC=C1CCC[C@@]2(C)C1CC[C@@H]2[C@H](C)C=C[C@H](C)C(C)C |
| InChI | InChI=1S/C31H47NO2/c1-22(2)23(3)10-11-25(5)28-14-15-29-26(9-7-17-30(28,29)6)12-13-27-21-31(33,18-16-24(27)4)34-20-8-19-32/h10-13,22-23,25,28-29,33H,4,7-9,14-18,20-21H2,1-3,5-6H3/t23-,25+,28+,29?,30+,31-/m0/s1 |
| InChIKey | XDWZDODFUGFTJQ-NCBJKLSWSA-N |
| XLogP | 7.90 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.72 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|