C18H17Cl2NO2 — CID 90850146
(2,3-dichlorophenyl) 4-phenylpiperidine-4-carboxylate (PubChem CID 90850146) has the molecular formula C18H17Cl2NO2 and a molecular weight of 350.25 g/mol. Its IUPAC name is (2,3-dichlorophenyl) 4-phenylpiperidine-4-carboxylate.
| Compound Name | (2,3-dichlorophenyl) 4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 90850146 |
| Molecular Formula | C18H17Cl2NO2 |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | (2,3-dichlorophenyl) 4-phenylpiperidine-4-carboxylate |
| SMILES | O=C(Oc1cccc(Cl)c1Cl)C1(c2ccccc2)CCNCC1 |
| InChI | InChI=1S/C18H17Cl2NO2/c19-14-7-4-8-15(16(14)20)23-17(22)18(9-11-21-12-10-18)13-5-2-1-3-6-13/h1-8,21H,9-12H2 |
| InChIKey | CXNKXOSOLMZCLA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|