C24H33NO3 — CID 90852715
3,4-dicyclohexyl-1-[2-(4-hydroxyphenyl)ethyl]pyrrole-2,5-diol (PubChem CID 90852715) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is 3,4-dicyclohexyl-1-[2-(4-hydroxyphenyl)ethyl]pyrrole-2,5-diol.
| Compound Name | 3,4-dicyclohexyl-1-[2-(4-hydroxyphenyl)ethyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90852715 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | 3,4-dicyclohexyl-1-[2-(4-hydroxyphenyl)ethyl]pyrrole-2,5-diol |
| SMILES | Oc1ccc(CCn2c(O)c(C3CCCCC3)c(C3CCCCC3)c2O)cc1 |
| InChI | InChI=1S/C24H33NO3/c26-20-13-11-17(12-14-20)15-16-25-23(27)21(18-7-3-1-4-8-18)22(24(25)28)19-9-5-2-6-10-19/h11-14,18-19,26-28H,1-10,15-16H2 |
| InChIKey | HCSGJLALPROUGB-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |