C29H54N2O2 — CID 90856551
3-(2,3-diethyl-3-methylpentyl)-4-(3-methylpentan-3-yl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrole-2,5-diol (PubChem CID 90856551) has the molecular formula C29H54N2O2 and a molecular weight of 462.76 g/mol. Its IUPAC name is 3-(2,3-diethyl-3-methylpentyl)-4-(3-methylpentan-3-yl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrole-2,5-diol.
| Compound Name | 3-(2,3-diethyl-3-methylpentyl)-4-(3-methylpentan-3-yl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90856551 |
| Molecular Formula | C29H54N2O2 |
| Molecular Weight | 462.76 g/mol |
| Exact Mass | 462.42 |
| IUPAC Name | 3-(2,3-diethyl-3-methylpentyl)-4-(3-methylpentan-3-yl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrole-2,5-diol |
| SMILES | CCC(Cc1c(C(C)(CC)CC)c(O)n(C2CC(C)(C)NC(C)(C)C2)c1O)C(C)(CC)CC |
| InChI | InChI=1S/C29H54N2O2/c1-12-20(28(10,13-2)14-3)17-22-23(29(11,15-4)16-5)25(33)31(24(22)32)21-18-26(6,7)30-27(8,9)19-21/h20-21,30,32-33H,12-19H2,1-11H3 |
| InChIKey | OEPCVWSNWLWEDG-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.76 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |