C21H39N3O5 — CID 90856999
ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate (PubChem CID 90856999) has the molecular formula C21H39N3O5 and a molecular weight of 413.56 g/mol. Its IUPAC name is ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate.
| Compound Name | ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate |
|---|---|
| PubChem CID | 90856999 |
| Molecular Formula | C21H39N3O5 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate |
| SMILES | CC.CCOCCOC(=O)N(CC(=O)N1CCCCC1)CC(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H33N3O5.C2H6/c1-2-26-13-14-27-19(25)22(15-17(23)20-9-5-3-6-10-20)16-18(24)21-11-7-4-8-12-21;1-2/h2-16H2,1H3;1-2H3 |
| InChIKey | IKIONOBPEBHKNX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|