About ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate
ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate (PubChem CID 90856999) has the molecular formula C21H39N3O5
and a molecular weight of 413.56 g/mol. Its IUPAC name is ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate.
Molecular Properties
| Compound Name | ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate |
| PubChem CID | 90856999 |
| Molecular Formula | C21H39N3O5 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate |
| SMILES | CC.CCOCCOC(=O)N(CC(=O)N1CCCCC1)CC(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H33N3O5.C2H6/c1-2-26-13-14-27-19(25)22(15-17(23)20-9-5-3-6-10-20)16-18(24)21-11-7-4-8-12-21;1-2/h2-16H2,1H3;1-2H3 |
| InChIKey | IKIONOBPEBHKNX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate?
The IUPAC name of ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate (CID 90856999) is ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate.
What is the SMILES notation for ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate?
The canonical SMILES for ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate is CC.CCOCCOC(=O)N(CC(=O)N1CCCCC1)CC(=O)N1CCCCC1.
What is the InChIKey of ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate?
The InChIKey is IKIONOBPEBHKNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33N3O5.C2H6/c1-2-26-13-14-27-19(25)22(15-17(23)20-9-5-3-6-10-20)16-18(24)21-11-7-4-8-12-21;1-2/h2-16H2,1H3;1-2H3.
What are the key properties of ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate?
ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate has a molecular weight of 413.56 g/mol, XLogP of 2.51, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethoxyethyl N,N-bis(2-oxo-2-piperidin-1-ylethyl)carbamate is sourced from PubChem (CID 90856999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).