About [4-(2,2-dimethylpropanoyl)phenyl]methyl 2-(methylamino)acetate
[4-(2,2-dimethylpropanoyl)phenyl]methyl 2-(methylamino)acetate (PubChem CID 90857236) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is [4-(2,2-dimethylpropanoyl)phenyl]methyl 2-(methylamino)acetate.
Analyze [4-(2,2-dimethylpropanoyl)phenyl]methyl 2-(methylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,2-dimethylpropanoyl)phenyl]methyl 2-(methylamino)acetate?
The IUPAC name of [4-(2,2-dimethylpropanoyl)phenyl]methyl 2-(methylamino)acetate (CID 90857236) is [4-(2,2-dimethylpropanoyl)phenyl]methyl 2-(methylamino)acetate.
What is the SMILES notation for [4-(2,2-dimethylpropanoyl)phenyl]methyl 2-(methylamino)acetate?
The canonical SMILES for [4-(2,2-dimethylpropanoyl)phenyl]methyl 2-(methylamino)acetate is CNCC(=O)OCc1ccc(C(=O)C(C)(C)C)cc1.
What is the InChIKey of [4-(2,2-dimethylpropanoyl)phenyl]methyl 2-(methylamino)acetate?
The InChIKey is FIUSUNAMMFGHTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-15(2,3)14(18)12-7-5-11(6-8-12)10-19-13(17)9-16-4/h5-8,16H,9-10H2,1-4H3.
What are the key properties of [4-(2,2-dimethylpropanoyl)phenyl]methyl 2-(methylamino)acetate?
[4-(2,2-dimethylpropanoyl)phenyl]methyl 2-(methylamino)acetate has a molecular weight of 263.34 g/mol, XLogP of 2.18, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,2-dimethylpropanoyl)phenyl]methyl 2-(methylamino)acetate is sourced from PubChem (CID 90857236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).