C12H21NO2 — CID 90857978
1-(2,4,4-trimethylpentan-2-yl)pyrrole-2,5-diol (PubChem CID 90857978) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 1-(2,4,4-trimethylpentan-2-yl)pyrrole-2,5-diol.
| Compound Name | 1-(2,4,4-trimethylpentan-2-yl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90857978 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 1-(2,4,4-trimethylpentan-2-yl)pyrrole-2,5-diol |
| SMILES | CC(C)(C)CC(C)(C)n1c(O)ccc1O |
| InChI | InChI=1S/C12H21NO2/c1-11(2,3)8-12(4,5)13-9(14)6-7-10(13)15/h6-7,14-15H,8H2,1-5H3 |
| InChIKey | XYYZVIMLEMZZGH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |