C17H21NO6 — CID 90861185
[9-(hydroxymethyl)-9-oxido-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 3-hydroxy-2-phenylpropanoate (PubChem CID 90861185) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is [9-(hydroxymethyl)-9-oxido-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 3-hydroxy-2-phenylpropanoate.
| Compound Name | [9-(hydroxymethyl)-9-oxido-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 3-hydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 90861185 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | [9-(hydroxymethyl)-9-oxido-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 3-hydroxy-2-phenylpropanoate |
| SMILES | O=C(OC1CC2C3OC3C(C1)[N+]2([O-])CO)C(CO)c1ccccc1 |
| InChI | InChI=1S/C17H21NO6/c19-8-12(10-4-2-1-3-5-10)17(21)23-11-6-13-15-16(24-15)14(7-11)18(13,22)9-20/h1-5,11-16,19-20H,6-9H2 |
| InChIKey | LQUIHGCWBGKNQZ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 102.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|